C9H15ClN4O — CID 106956316
2-(2-chloroethyl)-5-(4-methylpiperazin-1-yl)-1,3,4-oxadiazole (PubChem CID 106956316) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(4-methylpiperazin-1-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(4-methylpiperazin-1-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 106956316 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(2-chloroethyl)-5-(4-methylpiperazin-1-yl)-1,3,4-oxadiazole |
| SMILES | CN1CCN(c2nnc(CCCl)o2)CC1 |
| InChI | InChI=1S/C9H15ClN4O/c1-13-4-6-14(7-5-13)9-12-11-8(15-9)2-3-10/h2-7H2,1H3 |
| InChIKey | XTJXAKGXRXXSIY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|