C8H13ClN4O3S — CID 106957650
2-(chloromethyl)-5-(4-methylsulfonylpiperazin-1-yl)-1,3,4-oxadiazole (PubChem CID 106957650) has the molecular formula C8H13ClN4O3S and a molecular weight of 280.74 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(4-methylsulfonylpiperazin-1-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(4-methylsulfonylpiperazin-1-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 106957650 |
| Molecular Formula | C8H13ClN4O3S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-(chloromethyl)-5-(4-methylsulfonylpiperazin-1-yl)-1,3,4-oxadiazole |
| SMILES | CS(=O)(=O)N1CCN(c2nnc(CCl)o2)CC1 |
| InChI | InChI=1S/C8H13ClN4O3S/c1-17(14,15)13-4-2-12(3-5-13)8-11-10-7(6-9)16-8/h2-6H2,1H3 |
| InChIKey | MFMAIHGONLHPLG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|