C10H16ClN3OS — CID 106957832
2-(2-chloroethyl)-5-(2,6-dimethylthiomorpholin-4-yl)-1,3,4-oxadiazole (PubChem CID 106957832) has the molecular formula C10H16ClN3OS and a molecular weight of 261.78 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(2,6-dimethylthiomorpholin-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(2,6-dimethylthiomorpholin-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 106957832 |
| Molecular Formula | C10H16ClN3OS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-(2-chloroethyl)-5-(2,6-dimethylthiomorpholin-4-yl)-1,3,4-oxadiazole |
| SMILES | CC1CN(c2nnc(CCCl)o2)CC(C)S1 |
| InChI | InChI=1S/C10H16ClN3OS/c1-7-5-14(6-8(2)16-7)10-13-12-9(15-10)3-4-11/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZOLOENFNPNVQEZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|