C11H19ClN4O2 — CID 106958401
2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methylpropyl)propanamide (PubChem CID 106958401) has the molecular formula C11H19ClN4O2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 106958401 |
| Molecular Formula | C11H19ClN4O2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)C(C)Nc1nnc(CCCl)o1 |
| InChI | InChI=1S/C11H19ClN4O2/c1-7(2)6-13-10(17)8(3)14-11-16-15-9(18-11)4-5-12/h7-8H,4-6H2,1-3H3,(H,13,17)(H,14,16) |
| InChIKey | XBZXMVKNRWWDIM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|