C7H11ClN4O2 — CID 106957266
2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide (PubChem CID 106957266) has the molecular formula C7H11ClN4O2 and a molecular weight of 218.64 g/mol. Its IUPAC name is 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide.
| Compound Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106957266 |
| Molecular Formula | C7H11ClN4O2 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)Nc1nnc(CCl)o1 |
| InChI | InChI=1S/C7H11ClN4O2/c1-4(6(13)9-2)10-7-12-11-5(3-8)14-7/h4H,3H2,1-2H3,(H,9,13)(H,10,12) |
| InChIKey | KRBSGGUMSPUSTL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|