About 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide
2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide (PubChem CID 106957266) has the molecular formula C7H11ClN4O2
and a molecular weight of 218.64 g/mol. Its IUPAC name is 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide.
Molecular Properties
| Compound Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide |
| PubChem CID | 106957266 |
| Molecular Formula | C7H11ClN4O2 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)Nc1nnc(CCl)o1 |
| InChI | InChI=1S/C7H11ClN4O2/c1-4(6(13)9-2)10-7-12-11-5(3-8)14-7/h4H,3H2,1-2H3,(H,9,13)(H,10,12) |
| InChIKey | KRBSGGUMSPUSTL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide?
The IUPAC name of 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide (CID 106957266) is 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide.
What is the SMILES notation for 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide?
The canonical SMILES for 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide is CNC(=O)C(C)Nc1nnc(CCl)o1.
What is the InChIKey of 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide?
The InChIKey is KRBSGGUMSPUSTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN4O2/c1-4(6(13)9-2)10-7-12-11-5(3-8)14-7/h4H,3H2,1-2H3,(H,9,13)(H,10,12).
What are the key properties of 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide?
2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide has a molecular weight of 218.64 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]amino]-N-methylpropanamide is sourced from PubChem (CID 106957266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).