C11H22N4O3 — CID 106960024
2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]-propan-2-ylamino]ethanol (PubChem CID 106960024) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]-propan-2-ylamino]ethanol.
| Compound Name | 2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 106960024 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]-propan-2-ylamino]ethanol |
| SMILES | COCCNCc1nnc(N(CCO)C(C)C)o1 |
| InChI | InChI=1S/C11H22N4O3/c1-9(2)15(5-6-16)11-14-13-10(18-11)8-12-4-7-17-3/h9,12,16H,4-8H2,1-3H3 |
| InChIKey | VWCMUCOYXNDNNB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|