C11H22N4O4 — CID 106964675
2-[2-methoxyethyl-[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethanol (PubChem CID 106964675) has the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethanol.
| Compound Name | 2-[2-methoxyethyl-[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 106964675 |
| Molecular Formula | C11H22N4O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-[2-methoxyethyl-[5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethanol |
| SMILES | COCCNCc1nnc(N(CCO)CCOC)o1 |
| InChI | InChI=1S/C11H22N4O4/c1-17-7-3-12-9-10-13-14-11(19-10)15(4-6-16)5-8-18-2/h12,16H,3-9H2,1-2H3 |
| InChIKey | JDWVVTXHMWMBSX-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|