C11H19F3N4O2 — CID 106969915
5-[(2-methoxyethylamino)methyl]-N-propyl-N-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106969915) has the molecular formula C11H19F3N4O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-propyl-N-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-propyl-N-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106969915 |
| Molecular Formula | C11H19F3N4O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-propyl-N-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCN(CC(F)(F)F)c1nnc(CNCCOC)o1 |
| InChI | InChI=1S/C11H19F3N4O2/c1-3-5-18(8-11(12,13)14)10-17-16-9(20-10)7-15-4-6-19-2/h15H,3-8H2,1-2H3 |
| InChIKey | VALVUJYLSMLLGR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|