C14H19N5O2 — CID 106960840
5-(methylaminomethyl)-N-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106960840) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(methylaminomethyl)-N-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106960840 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 5-(methylaminomethyl)-N-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CNCc1nnc(Nc2ccc(N3CCOCC3)cc2)o1 |
| InChI | InChI=1S/C14H19N5O2/c1-15-10-13-17-18-14(21-13)16-11-2-4-12(5-3-11)19-6-8-20-9-7-19/h2-5,15H,6-10H2,1H3,(H,16,18) |
| InChIKey | HLRJCMKIALOMRY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|