C14H21N5O — CID 106960890
1-N-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 106960890) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-N-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 106960890 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-N-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nnc(C(C)N)o2)cc1 |
| InChI | InChI=1S/C14H21N5O/c1-4-19(5-2)12-8-6-11(7-9-12)16-14-18-17-13(20-14)10(3)15/h6-10H,4-5,15H2,1-3H3,(H,16,18) |
| InChIKey | ZCJUPTOFHHXNNO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|