C15H28N2OSi — CID 71413629
1-N-[dimethyl(propan-2-yloxy)silyl]-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 71413629) has the molecular formula C15H28N2OSi and a molecular weight of 280.49 g/mol. Its IUPAC name is 1-N-[dimethyl(propan-2-yloxy)silyl]-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-[dimethyl(propan-2-yloxy)silyl]-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 71413629 |
| Molecular Formula | C15H28N2OSi |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-N-[dimethyl(propan-2-yloxy)silyl]-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(N[Si](C)(C)OC(C)C)cc1 |
| InChI | InChI=1S/C15H28N2OSi/c1-7-17(8-2)15-11-9-14(10-12-15)16-19(5,6)18-13(3)4/h9-13,16H,7-8H2,1-6H3 |
| InChIKey | ZEQQQZXOFLXCPT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|