C10H20N4O — CID 106961130
5-(1-aminoethyl)-N-(4-methylpentyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106961130) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-(1-aminoethyl)-N-(4-methylpentyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-aminoethyl)-N-(4-methylpentyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106961130 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 5-(1-aminoethyl)-N-(4-methylpentyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(C)CCCNc1nnc(C(C)N)o1 |
| InChI | InChI=1S/C10H20N4O/c1-7(2)5-4-6-12-10-14-13-9(15-10)8(3)11/h7-8H,4-6,11H2,1-3H3,(H,12,14) |
| InChIKey | RMDHPRJFWBRSLP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|