C13H26N4O — CID 114004538
5-(1-aminoethyl)-N-(7-methyloctyl)-1,3,4-oxadiazol-2-amine (PubChem CID 114004538) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is 5-(1-aminoethyl)-N-(7-methyloctyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-aminoethyl)-N-(7-methyloctyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 114004538 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 5-(1-aminoethyl)-N-(7-methyloctyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(C)CCCCCCNc1nnc(C(C)N)o1 |
| InChI | InChI=1S/C13H26N4O/c1-10(2)8-6-4-5-7-9-15-13-17-16-12(18-13)11(3)14/h10-11H,4-9,14H2,1-3H3,(H,15,17) |
| InChIKey | NKALBYMTKNETRW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|