C11H17N5OS — CID 106962100
5-(propylaminomethyl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106962100) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is 5-(propylaminomethyl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(propylaminomethyl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106962100 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 5-(propylaminomethyl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(NC(C)c2nccs2)o1 |
| InChI | InChI=1S/C11H17N5OS/c1-3-4-12-7-9-15-16-11(17-9)14-8(2)10-13-5-6-18-10/h5-6,8,12H,3-4,7H2,1-2H3,(H,14,16) |
| InChIKey | NECAAWNZQCXHDF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|