C10H15N5O3 — CID 106962572
1-methyl-3-[[5-[1-(methylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]pyrrolidine-2,5-dione (PubChem CID 106962572) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-methyl-3-[[5-[1-(methylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-[[5-[1-(methylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106962572 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-methyl-3-[[5-[1-(methylamino)ethyl]-1,3,4-oxadiazol-2-yl]amino]pyrrolidine-2,5-dione |
| SMILES | CNC(C)c1nnc(NC2CC(=O)N(C)C2=O)o1 |
| InChI | InChI=1S/C10H15N5O3/c1-5(11-2)8-13-14-10(18-8)12-6-4-7(16)15(3)9(6)17/h5-6,11H,4H2,1-3H3,(H,12,14) |
| InChIKey | BLFATMWAUYBPFO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|