C9H9IN4O2 — CID 116648433
3-[(5-iodopyrimidin-2-yl)amino]-1-methylpyrrolidine-2,5-dione (PubChem CID 116648433) has the molecular formula C9H9IN4O2 and a molecular weight of 332.10 g/mol. Its IUPAC name is 3-[(5-iodopyrimidin-2-yl)amino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-iodopyrimidin-2-yl)amino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 116648433 |
| Molecular Formula | C9H9IN4O2 |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 3-[(5-iodopyrimidin-2-yl)amino]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Nc2ncc(I)cn2)C1=O |
| InChI | InChI=1S/C9H9IN4O2/c1-14-7(15)2-6(8(14)16)13-9-11-3-5(10)4-12-9/h3-4,6H,2H2,1H3,(H,11,12,13) |
| InChIKey | OIZNHPIAUFXFFT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|