C16H23N — CID 106985356
5,7-dimethyl-3-(2-methylpentyl)-1H-indole (PubChem CID 106985356) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 5,7-dimethyl-3-(2-methylpentyl)-1H-indole.
| Compound Name | 5,7-dimethyl-3-(2-methylpentyl)-1H-indole |
|---|---|
| PubChem CID | 106985356 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 5,7-dimethyl-3-(2-methylpentyl)-1H-indole |
| SMILES | CCCC(C)Cc1c[nH]c2c(C)cc(C)cc12 |
| InChI | InChI=1S/C16H23N/c1-5-6-11(2)8-14-10-17-16-13(4)7-12(3)9-15(14)16/h7,9-11,17H,5-6,8H2,1-4H3 |
| InChIKey | ZJXCEMCUXRVJTH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |