C16H24N2 — CID 96674980
3-(5,7-dimethyl-1H-indol-3-yl)-N-propan-2-ylpropan-1-amine (PubChem CID 96674980) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-(5,7-dimethyl-1H-indol-3-yl)-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-(5,7-dimethyl-1H-indol-3-yl)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 96674980 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-(5,7-dimethyl-1H-indol-3-yl)-N-propan-2-ylpropan-1-amine |
| SMILES | Cc1cc(C)c2[nH]cc(CCCNC(C)C)c2c1 |
| InChI | InChI=1S/C16H24N2/c1-11(2)17-7-5-6-14-10-18-16-13(4)8-12(3)9-15(14)16/h8-11,17-18H,5-7H2,1-4H3 |
| InChIKey | NALAMKGLTBBMHN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|