C12H12N2 — CID 82490743
2-(5,7-dimethyl-1H-indol-3-yl)acetonitrile (PubChem CID 82490743) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(5,7-dimethyl-1H-indol-3-yl)acetonitrile.
| Compound Name | 2-(5,7-dimethyl-1H-indol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 82490743 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-(5,7-dimethyl-1H-indol-3-yl)acetonitrile |
| SMILES | Cc1cc(C)c2[nH]cc(CC#N)c2c1 |
| InChI | InChI=1S/C12H12N2/c1-8-5-9(2)12-11(6-8)10(3-4-13)7-14-12/h5-7,14H,3H2,1-2H3 |
| InChIKey | UFDLQFXVNMCASL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |