C15H15F2N — CID 106985396
3-(2-bicyclo[2.2.1]heptanyl)-5,7-difluoro-1H-indole (PubChem CID 106985396) has the molecular formula C15H15F2N and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanyl)-5,7-difluoro-1H-indole.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanyl)-5,7-difluoro-1H-indole |
|---|---|
| PubChem CID | 106985396 |
| Molecular Formula | C15H15F2N |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanyl)-5,7-difluoro-1H-indole |
| SMILES | Fc1cc(F)c2[nH]cc(C3CC4CCC3C4)c2c1 |
| InChI | InChI=1S/C15H15F2N/c16-10-5-12-13(7-18-15(12)14(17)6-10)11-4-8-1-2-9(11)3-8/h5-9,11,18H,1-4H2 |
| InChIKey | DVOZDZOMJUQART-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |