C14H14BrF3 — CID 63438557
2-[bromo-(2,4,6-trifluorophenyl)methyl]bicyclo[2.2.1]heptane (PubChem CID 63438557) has the molecular formula C14H14BrF3 and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-[bromo-(2,4,6-trifluorophenyl)methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[bromo-(2,4,6-trifluorophenyl)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63438557 |
| Molecular Formula | C14H14BrF3 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-[bromo-(2,4,6-trifluorophenyl)methyl]bicyclo[2.2.1]heptane |
| SMILES | Fc1cc(F)c(C(Br)C2CC3CCC2C3)c(F)c1 |
| InChI | InChI=1S/C14H14BrF3/c15-14(10-4-7-1-2-8(10)3-7)13-11(17)5-9(16)6-12(13)18/h5-8,10,14H,1-4H2 |
| InChIKey | CUAYLGSQLBCHAE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|