C17H21BrO2 — CID 63437502
7-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 63437502) has the molecular formula C17H21BrO2 and a molecular weight of 337.26 g/mol. Its IUPAC name is 7-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 63437502 |
| Molecular Formula | C17H21BrO2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 7-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | BrC(c1ccc2c(c1)OCCCO2)C1CC2CCC1C2 |
| InChI | InChI=1S/C17H21BrO2/c18-17(14-9-11-2-3-12(14)8-11)13-4-5-15-16(10-13)20-7-1-6-19-15/h4-5,10-12,14,17H,1-3,6-9H2 |
| InChIKey | XLUVUBQGWJPEFW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|