C19H21BrO — CID 63443862
2-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-6-methoxynaphthalene (PubChem CID 63443862) has the molecular formula C19H21BrO and a molecular weight of 345.28 g/mol. Its IUPAC name is 2-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-6-methoxynaphthalene.
| Compound Name | 2-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-6-methoxynaphthalene |
|---|---|
| PubChem CID | 63443862 |
| Molecular Formula | C19H21BrO |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[2-bicyclo[2.2.1]heptanyl(bromo)methyl]-6-methoxynaphthalene |
| SMILES | COc1ccc2cc(C(Br)C3CC4CCC3C4)ccc2c1 |
| InChI | InChI=1S/C19H21BrO/c1-21-17-7-6-13-10-16(5-4-14(13)11-17)19(20)18-9-12-2-3-15(18)8-12/h4-7,10-12,15,18-19H,2-3,8-9H2,1H3 |
| InChIKey | LADMRSZLBMZMRS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|