C18H25Br — CID 63435569
2-[bromo-[4-(2-methylpropyl)phenyl]methyl]bicyclo[2.2.1]heptane (PubChem CID 63435569) has the molecular formula C18H25Br and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-[bromo-[4-(2-methylpropyl)phenyl]methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[bromo-[4-(2-methylpropyl)phenyl]methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63435569 |
| Molecular Formula | C18H25Br |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[bromo-[4-(2-methylpropyl)phenyl]methyl]bicyclo[2.2.1]heptane |
| SMILES | CC(C)Cc1ccc(C(Br)C2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C18H25Br/c1-12(2)9-13-3-6-15(7-4-13)18(19)17-11-14-5-8-16(17)10-14/h3-4,6-7,12,14,16-18H,5,8-11H2,1-2H3 |
| InChIKey | ZSIOBRDLSQBBEA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|