C16H27NO4 — CID 106988774
1-[2-[(1R)-1-aminoethyl]-5-methylphenoxy]-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106988774) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[2-[(1R)-1-aminoethyl]-5-methylphenoxy]-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-[2-[(1R)-1-aminoethyl]-5-methylphenoxy]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106988774 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-[2-[(1R)-1-aminoethyl]-5-methylphenoxy]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCC(C)OCC(O)COc1cc(C)ccc1[C@@H](C)N |
| InChI | InChI=1S/C16H27NO4/c1-11-5-6-15(13(3)17)16(7-11)21-10-14(18)9-20-12(2)8-19-4/h5-7,12-14,18H,8-10,17H2,1-4H3/t12?,13-,14?/m1/s1 |
| InChIKey | AJCHYHHIDDEZOZ-ROKHWSDSSA-N |
| XLogP | 1.81 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |