C11H23NO3S2 — CID 106990535
1-(1,4-dithian-2-ylmethylamino)-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106990535) has the molecular formula C11H23NO3S2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-(1,4-dithian-2-ylmethylamino)-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-(1,4-dithian-2-ylmethylamino)-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106990535 |
| Molecular Formula | C11H23NO3S2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-(1,4-dithian-2-ylmethylamino)-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CNCC1CSCCS1 |
| InChI | InChI=1S/C11H23NO3S2/c1-14-2-3-15-8-10(13)6-12-7-11-9-16-4-5-17-11/h10-13H,2-9H2,1H3 |
| InChIKey | YIYYMVQOANQINL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|