C11H20N2O3S2 — CID 103264379
methyl 2-acetamido-3-(1,4-dithian-2-ylmethylamino)propanoate (PubChem CID 103264379) has the molecular formula C11H20N2O3S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is methyl 2-acetamido-3-(1,4-dithian-2-ylmethylamino)propanoate.
| Compound Name | methyl 2-acetamido-3-(1,4-dithian-2-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 103264379 |
| Molecular Formula | C11H20N2O3S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 2-acetamido-3-(1,4-dithian-2-ylmethylamino)propanoate |
| SMILES | COC(=O)C(CNCC1CSCCS1)NC(C)=O |
| InChI | InChI=1S/C11H20N2O3S2/c1-8(14)13-10(11(15)16-2)6-12-5-9-7-17-3-4-18-9/h9-10,12H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | QEOXABARXIHVBF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |