C10H17NO2S2 — CID 103264360
4-(1,4-dithian-2-ylmethylamino)-3-methylbut-2-enoic acid (PubChem CID 103264360) has the molecular formula C10H17NO2S2 and a molecular weight of 247.38 g/mol. Its IUPAC name is 4-(1,4-dithian-2-ylmethylamino)-3-methylbut-2-enoic acid.
| Compound Name | 4-(1,4-dithian-2-ylmethylamino)-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103264360 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4-(1,4-dithian-2-ylmethylamino)-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNCC1CSCCS1 |
| InChI | InChI=1S/C10H17NO2S2/c1-8(4-10(12)13)5-11-6-9-7-14-2-3-15-9/h4,9,11H,2-3,5-7H2,1H3,(H,12,13) |
| InChIKey | IKDNHUHGSJXFJJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|