C9H18OS2 — CID 145332345
1-(1,4-dithian-2-yl)propan-2-one;ethane (PubChem CID 145332345) has the molecular formula C9H18OS2 and a molecular weight of 206.38 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)propan-2-one;ethane.
| Compound Name | 1-(1,4-dithian-2-yl)propan-2-one;ethane |
|---|---|
| PubChem CID | 145332345 |
| Molecular Formula | C9H18OS2 |
| Molecular Weight | 206.38 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-(1,4-dithian-2-yl)propan-2-one;ethane |
| SMILES | CC.CC(=O)CC1CSCCS1 |
| InChI | InChI=1S/C7H12OS2.C2H6/c1-6(8)4-7-5-9-2-3-10-7;1-2/h7H,2-5H2,1H3;1-2H3 |
| InChIKey | FHTDHPNWNQFYNK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |