C8H17NO2S2 — CID 104866322
(2S)-3-(1,4-dithian-2-ylmethylamino)propane-1,2-diol (PubChem CID 104866322) has the molecular formula C8H17NO2S2 and a molecular weight of 223.36 g/mol. Its IUPAC name is (2S)-3-(1,4-dithian-2-ylmethylamino)propane-1,2-diol.
| Compound Name | (2S)-3-(1,4-dithian-2-ylmethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 104866322 |
| Molecular Formula | C8H17NO2S2 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (2S)-3-(1,4-dithian-2-ylmethylamino)propane-1,2-diol |
| SMILES | OC[C@@H](O)CNCC1CSCCS1 |
| InChI | InChI=1S/C8H17NO2S2/c10-5-7(11)3-9-4-8-6-12-1-2-13-8/h7-11H,1-6H2/t7-,8?/m0/s1 |
| InChIKey | MCEKZMIUYCTNKA-JAMMHHFISA-N |
| XLogP | -0.22 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |