C10H21NOS2 — CID 115972534
4-(1,4-dithian-2-ylmethylamino)pentan-1-ol (PubChem CID 115972534) has the molecular formula C10H21NOS2 and a molecular weight of 235.42 g/mol. Its IUPAC name is 4-(1,4-dithian-2-ylmethylamino)pentan-1-ol.
| Compound Name | 4-(1,4-dithian-2-ylmethylamino)pentan-1-ol |
|---|---|
| PubChem CID | 115972534 |
| Molecular Formula | C10H21NOS2 |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-(1,4-dithian-2-ylmethylamino)pentan-1-ol |
| SMILES | CC(CCCO)NCC1CSCCS1 |
| InChI | InChI=1S/C10H21NOS2/c1-9(3-2-4-12)11-7-10-8-13-5-6-14-10/h9-12H,2-8H2,1H3 |
| InChIKey | ZSKNZIBNGTWVMR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |