C13H27NO3 — CID 106991982
1-(2,4-dimethylpiperidin-1-yl)-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106991982) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 1-(2,4-dimethylpiperidin-1-yl)-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-(2,4-dimethylpiperidin-1-yl)-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106991982 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 1-(2,4-dimethylpiperidin-1-yl)-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CN1CCC(C)CC1C |
| InChI | InChI=1S/C13H27NO3/c1-11-4-5-14(12(2)8-11)9-13(15)10-17-7-6-16-3/h11-13,15H,4-10H2,1-3H3 |
| InChIKey | GUPYJDMCVAVJNU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|