C11H23NO5S — CID 106992286
1-(2-methoxyethoxy)-3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol (PubChem CID 106992286) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol.
| Compound Name | 1-(2-methoxyethoxy)-3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 106992286 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(2-methoxyethoxy)-3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol |
| SMILES | COCCOCC(O)CN1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C11H23NO5S/c1-10-9-18(14,15)6-3-12(10)7-11(13)8-17-5-4-16-2/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | NGCMGCYOOXSCHD-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|