C13H23NO5 — CID 106991473
7-[2-hydroxy-3-(2-methoxyethoxy)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 106991473) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(2-methoxyethoxy)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 7-[2-hydroxy-3-(2-methoxyethoxy)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 106991473 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 7-[2-hydroxy-3-(2-methoxyethoxy)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | COCCOCC(O)CN1C2CCC1C(C(=O)O)C2 |
| InChI | InChI=1S/C13H23NO5/c1-18-4-5-19-8-10(15)7-14-9-2-3-12(14)11(6-9)13(16)17/h9-12,15H,2-8H2,1H3,(H,16,17) |
| InChIKey | JLUYNNHIXODMQM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|