C12H21N3O3 — CID 106992023
1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106992023) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106992023 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H21N3O3/c1-17-6-7-18-10-11(16)8-14-4-5-15-3-2-13-12(15)9-14/h2-3,11,16H,4-10H2,1H3 |
| InChIKey | PWVYKHKJPXBXPF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|