About 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol
1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol (PubChem CID 104752839) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol |
| PubChem CID | 104752839 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol |
| SMILES | OC(CN1CCn2ccnc2C1)C1CCCCC1 |
| InChI | InChI=1S/C14H23N3O/c18-13(12-4-2-1-3-5-12)10-16-8-9-17-7-6-15-14(17)11-16/h6-7,12-13,18H,1-5,8-11H2 |
| InChIKey | GOWIYFIMCMLOBC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol?
The IUPAC name of 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol (CID 104752839) is 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol.
What is the SMILES notation for 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol?
The canonical SMILES for 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol is OC(CN1CCn2ccnc2C1)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol?
The InChIKey is GOWIYFIMCMLOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c18-13(12-4-2-1-3-5-12)10-16-8-9-17-7-6-15-14(17)11-16/h6-7,12-13,18H,1-5,8-11H2.
What are the key properties of 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol?
1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol has a molecular weight of 249.36 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)ethanol is sourced from PubChem (CID 104752839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).