C10H21NO5 — CID 106993176
2-(2-aminoethyl)-4-hydroxy-5-(2-methoxyethoxy)pentanoic acid (PubChem CID 106993176) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-hydroxy-5-(2-methoxyethoxy)pentanoic acid.
| Compound Name | 2-(2-aminoethyl)-4-hydroxy-5-(2-methoxyethoxy)pentanoic acid |
|---|---|
| PubChem CID | 106993176 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(2-aminoethyl)-4-hydroxy-5-(2-methoxyethoxy)pentanoic acid |
| SMILES | COCCOCC(O)CC(CCN)C(=O)O |
| InChI | InChI=1S/C10H21NO5/c1-15-4-5-16-7-9(12)6-8(2-3-11)10(13)14/h8-9,12H,2-7,11H2,1H3,(H,13,14) |
| InChIKey | JHVSNAFXMMMKCJ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|