C11H11Cl2F3N2 — CID 106993674
N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)cyclopropanamine (PubChem CID 106993674) has the molecular formula C11H11Cl2F3N2 and a molecular weight of 299.12 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)cyclopropanamine.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)cyclopropanamine |
|---|---|
| PubChem CID | 106993674 |
| Molecular Formula | C11H11Cl2F3N2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)cyclopropanamine |
| SMILES | FC(F)(F)CN(Cc1ccc(Cl)nc1Cl)C1CC1 |
| InChI | InChI=1S/C11H11Cl2F3N2/c12-9-4-1-7(10(13)17-9)5-18(8-2-3-8)6-11(14,15)16/h1,4,8H,2-3,5-6H2 |
| InChIKey | CSYPNIVUKOMCOM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|