C13H18Cl2N2 — CID 106993827
2,6-dichloro-3-[(2-propan-2-ylpyrrolidin-1-yl)methyl]pyridine (PubChem CID 106993827) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2,6-dichloro-3-[(2-propan-2-ylpyrrolidin-1-yl)methyl]pyridine.
| Compound Name | 2,6-dichloro-3-[(2-propan-2-ylpyrrolidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 106993827 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,6-dichloro-3-[(2-propan-2-ylpyrrolidin-1-yl)methyl]pyridine |
| SMILES | CC(C)C1CCCN1Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C13H18Cl2N2/c1-9(2)11-4-3-7-17(11)8-10-5-6-12(14)16-13(10)15/h5-6,9,11H,3-4,7-8H2,1-2H3 |
| InChIKey | RKJMMQXRRIOGIL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|