C13H10BrCl2NO — CID 106994644
3-[(4-bromo-3-methylphenoxy)methyl]-2,6-dichloropyridine (PubChem CID 106994644) has the molecular formula C13H10BrCl2NO and a molecular weight of 347.04 g/mol. Its IUPAC name is 3-[(4-bromo-3-methylphenoxy)methyl]-2,6-dichloropyridine.
| Compound Name | 3-[(4-bromo-3-methylphenoxy)methyl]-2,6-dichloropyridine |
|---|---|
| PubChem CID | 106994644 |
| Molecular Formula | C13H10BrCl2NO |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | 3-[(4-bromo-3-methylphenoxy)methyl]-2,6-dichloropyridine |
| SMILES | Cc1cc(OCc2ccc(Cl)nc2Cl)ccc1Br |
| InChI | InChI=1S/C13H10BrCl2NO/c1-8-6-10(3-4-11(8)14)18-7-9-2-5-12(15)17-13(9)16/h2-6H,7H2,1H3 |
| InChIKey | VKKMJXGUIUBPOJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|