C13H10BrCl2NO2 — CID 106994652
3-[(2-bromo-4-methoxyphenoxy)methyl]-2,6-dichloropyridine (PubChem CID 106994652) has the molecular formula C13H10BrCl2NO2 and a molecular weight of 363.04 g/mol. Its IUPAC name is 3-[(2-bromo-4-methoxyphenoxy)methyl]-2,6-dichloropyridine.
| Compound Name | 3-[(2-bromo-4-methoxyphenoxy)methyl]-2,6-dichloropyridine |
|---|---|
| PubChem CID | 106994652 |
| Molecular Formula | C13H10BrCl2NO2 |
| Molecular Weight | 363.04 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | 3-[(2-bromo-4-methoxyphenoxy)methyl]-2,6-dichloropyridine |
| SMILES | COc1ccc(OCc2ccc(Cl)nc2Cl)c(Br)c1 |
| InChI | InChI=1S/C13H10BrCl2NO2/c1-18-9-3-4-11(10(14)6-9)19-7-8-2-5-12(15)17-13(8)16/h2-6H,7H2,1H3 |
| InChIKey | RDODEKRHBGYEFB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|