C12H14BrN5O3 — CID 106999146
5-bromo-2-(3,5-diethyl-4-nitropyrazol-1-yl)-4-methoxypyrimidine (PubChem CID 106999146) has the molecular formula C12H14BrN5O3 and a molecular weight of 356.18 g/mol. Its IUPAC name is 5-bromo-2-(3,5-diethyl-4-nitropyrazol-1-yl)-4-methoxypyrimidine.
| Compound Name | 5-bromo-2-(3,5-diethyl-4-nitropyrazol-1-yl)-4-methoxypyrimidine |
|---|---|
| PubChem CID | 106999146 |
| Molecular Formula | C12H14BrN5O3 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 5-bromo-2-(3,5-diethyl-4-nitropyrazol-1-yl)-4-methoxypyrimidine |
| SMILES | CCc1nn(-c2ncc(Br)c(OC)n2)c(CC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14BrN5O3/c1-4-8-10(18(19)20)9(5-2)17(16-8)12-14-6-7(13)11(15-12)21-3/h6H,4-5H2,1-3H3 |
| InChIKey | JZYGODHDMJCKCA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|