C7H4Br2N6O3 — CID 106999148
5-bromo-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-4-methoxypyrimidine (PubChem CID 106999148) has the molecular formula C7H4Br2N6O3 and a molecular weight of 379.96 g/mol. Its IUPAC name is 5-bromo-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-4-methoxypyrimidine.
| Compound Name | 5-bromo-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-4-methoxypyrimidine |
|---|---|
| PubChem CID | 106999148 |
| Molecular Formula | C7H4Br2N6O3 |
| Molecular Weight | 379.96 g/mol |
| Exact Mass | 377.87 |
| IUPAC Name | 5-bromo-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-4-methoxypyrimidine |
| SMILES | COc1nc(-n2nc([N+](=O)[O-])nc2Br)ncc1Br |
| InChI | InChI=1S/C7H4Br2N6O3/c1-18-4-3(8)2-10-6(11-4)14-5(9)12-7(13-14)15(16)17/h2H,1H3 |
| InChIKey | OJSXOGHRBVYCTP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.96 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|