C13H18ClN — CID 107003679
2-[1-chloro-1-(2,2-dimethylcyclopropyl)propan-2-yl]pyridine (PubChem CID 107003679) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 2-[1-chloro-1-(2,2-dimethylcyclopropyl)propan-2-yl]pyridine.
| Compound Name | 2-[1-chloro-1-(2,2-dimethylcyclopropyl)propan-2-yl]pyridine |
|---|---|
| PubChem CID | 107003679 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-[1-chloro-1-(2,2-dimethylcyclopropyl)propan-2-yl]pyridine |
| SMILES | CC(c1ccccn1)C(Cl)C1CC1(C)C |
| InChI | InChI=1S/C13H18ClN/c1-9(11-6-4-5-7-15-11)12(14)10-8-13(10,2)3/h4-7,9-10,12H,8H2,1-3H3 |
| InChIKey | WDVDRJACPDDWGZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|