C19H24O2 — CID 107007499
(1S)-1-(1-hept-6-enoxynaphthalen-2-yl)ethanol (PubChem CID 107007499) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (1S)-1-(1-hept-6-enoxynaphthalen-2-yl)ethanol.
| Compound Name | (1S)-1-(1-hept-6-enoxynaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 107007499 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (1S)-1-(1-hept-6-enoxynaphthalen-2-yl)ethanol |
| SMILES | C=CCCCCCOc1c([C@H](C)O)ccc2ccccc12 |
| InChI | InChI=1S/C19H24O2/c1-3-4-5-6-9-14-21-19-17(15(2)20)13-12-16-10-7-8-11-18(16)19/h3,7-8,10-13,15,20H,1,4-6,9,14H2,2H3/t15-/m0/s1 |
| InChIKey | JTUFMGHDMPGKFE-HNNXBMFYSA-N |
| XLogP | 5.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|