C17H23NO2 — CID 107007899
(3S)-2-hept-6-enyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 107007899) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (3S)-2-hept-6-enyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3S)-2-hept-6-enyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 107007899 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (3S)-2-hept-6-enyl-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | C=CCCCCCN1Cc2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C17H23NO2/c1-2-3-4-5-8-11-18-13-15-10-7-6-9-14(15)12-16(18)17(19)20/h2,6-7,9-10,16H,1,3-5,8,11-13H2,(H,19,20)/t16-/m0/s1 |
| InChIKey | TWNHCZBRMLZCGO-INIZCTEOSA-N |
| XLogP | 3.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|