C12H16N2O4S — CID 114385367
2-(2-sulfamoylethyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 114385367) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(2-sulfamoylethyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-(2-sulfamoylethyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 114385367 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(2-sulfamoylethyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | NS(=O)(=O)CCN1Cc2ccccc2CC1C(=O)O |
| InChI | InChI=1S/C12H16N2O4S/c13-19(17,18)6-5-14-8-10-4-2-1-3-9(10)7-11(14)12(15)16/h1-4,11H,5-8H2,(H,15,16)(H2,13,17,18) |
| InChIKey | PLEUCVSVCUNJNB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |