C13H17NO5S — CID 11266538
2-(3-sulfopropyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 11266538) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(3-sulfopropyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-(3-sulfopropyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11266538 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(3-sulfopropyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2CN1CCCS(=O)(=O)O |
| InChI | InChI=1S/C13H17NO5S/c15-13(16)12-8-10-4-1-2-5-11(10)9-14(12)6-3-7-20(17,18)19/h1-2,4-5,12H,3,6-9H2,(H,15,16)(H,17,18,19) |
| InChIKey | CPZJCVRFLOKCOW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|