C15H22N2 — CID 107008081
1-hept-6-enyl-2,3-dihydroindol-7-amine (PubChem CID 107008081) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-hept-6-enyl-2,3-dihydroindol-7-amine.
| Compound Name | 1-hept-6-enyl-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 107008081 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-hept-6-enyl-2,3-dihydroindol-7-amine |
| SMILES | C=CCCCCCN1CCc2cccc(N)c21 |
| InChI | InChI=1S/C15H22N2/c1-2-3-4-5-6-11-17-12-10-13-8-7-9-14(16)15(13)17/h2,7-9H,1,3-6,10-12,16H2 |
| InChIKey | BAXSLYRSFMDHNK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|