C13H20N2OS — CID 107010915
1-[2-(1-aminoethyl)-1,3-thiazol-4-yl]oct-7-en-1-one (PubChem CID 107010915) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)-1,3-thiazol-4-yl]oct-7-en-1-one.
| Compound Name | 1-[2-(1-aminoethyl)-1,3-thiazol-4-yl]oct-7-en-1-one |
|---|---|
| PubChem CID | 107010915 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-[2-(1-aminoethyl)-1,3-thiazol-4-yl]oct-7-en-1-one |
| SMILES | C=CCCCCCC(=O)c1csc(C(C)N)n1 |
| InChI | InChI=1S/C13H20N2OS/c1-3-4-5-6-7-8-12(16)11-9-17-13(15-11)10(2)14/h3,9-10H,1,4-8,14H2,2H3 |
| InChIKey | QZVCDWJSXOLXAO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|